C10H9F3 — CID 170403095
(3E,5E)-3-methyl-6-(trifluoromethyl)octa-1,3,5-trien-7-yne (PubChem CID 170403095) has the molecular formula C10H9F3 and a molecular weight of 186.18 g/mol. Its IUPAC name is (3E,5E)-3-methyl-6-(trifluoromethyl)octa-1,3,5-trien-7-yne.
| Compound Name | (3E,5E)-3-methyl-6-(trifluoromethyl)octa-1,3,5-trien-7-yne |
|---|---|
| PubChem CID | 170403095 |
| Molecular Formula | C10H9F3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (3E,5E)-3-methyl-6-(trifluoromethyl)octa-1,3,5-trien-7-yne |
| SMILES | C#C/C(=C\C=C(/C)C=C)C(F)(F)F |
| InChI | InChI=1S/C10H9F3/c1-4-8(3)6-7-9(5-2)10(11,12)13/h2,4,6-7H,1H2,3H3/b8-6+,9-7+ |
| InChIKey | VNVMGLDLBDKXTQ-CDJQDVQCSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|