C19H11F6NO2 — CID 170403281
(2S)-4-but-3-ynyl-7-fluoro-2-methyl-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one (PubChem CID 170403281) has the molecular formula C19H11F6NO2 and a molecular weight of 399.29 g/mol. Its IUPAC name is (2S)-4-but-3-ynyl-7-fluoro-2-methyl-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one.
| Compound Name | (2S)-4-but-3-ynyl-7-fluoro-2-methyl-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170403281 |
| Molecular Formula | C19H11F6NO2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (2S)-4-but-3-ynyl-7-fluoro-2-methyl-6-(2,3,4,5,6-pentafluorophenyl)-1,4-benzoxazin-3-one |
| SMILES | C#CCCN1C(=O)[C@H](C)Oc2cc(F)c(-c3c(F)c(F)c(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C19H11F6NO2/c1-3-4-5-26-11-6-9(10(20)7-12(11)28-8(2)19(26)27)13-14(21)16(23)18(25)17(24)15(13)22/h1,6-8H,4-5H2,2H3/t8-/m0/s1 |
| InChIKey | NRAMLNQYFAXXOI-QMMMGPOBSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|