About 2,5-bis(ethenyl)-1,4-dithiane
2,5-bis(ethenyl)-1,4-dithiane (PubChem CID 170403521) has the molecular formula C8H12S2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 2,5-bis(ethenyl)-1,4-dithiane.
Molecular Properties
| Compound Name | 2,5-bis(ethenyl)-1,4-dithiane |
| PubChem CID | 170403521 |
| Molecular Formula | C8H12S2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2,5-bis(ethenyl)-1,4-dithiane |
| SMILES | C=CC1CSC(C=C)CS1 |
| InChI | InChI=1S/C8H12S2/c1-3-7-5-10-8(4-2)6-9-7/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | YHWYBRUYJLFQFK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(ethenyl)-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(ethenyl)-1,4-dithiane?
The IUPAC name of 2,5-bis(ethenyl)-1,4-dithiane (CID 170403521) is 2,5-bis(ethenyl)-1,4-dithiane.
What is the SMILES notation for 2,5-bis(ethenyl)-1,4-dithiane?
The canonical SMILES for 2,5-bis(ethenyl)-1,4-dithiane is C=CC1CSC(C=C)CS1.
What is the InChIKey of 2,5-bis(ethenyl)-1,4-dithiane?
The InChIKey is YHWYBRUYJLFQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S2/c1-3-7-5-10-8(4-2)6-9-7/h3-4,7-8H,1-2,5-6H2.
What are the key properties of 2,5-bis(ethenyl)-1,4-dithiane?
2,5-bis(ethenyl)-1,4-dithiane has a molecular weight of 172.32 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethenyl)-1,4-dithiane is sourced from PubChem (CID 170403521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).