C15H9N3 — CID 170403777
2,4,6-tris(but-3-en-1-ynyl)-1,3,5-triazine (PubChem CID 170403777) has the molecular formula C15H9N3 and a molecular weight of 231.26 g/mol. Its IUPAC name is 2,4,6-tris(but-3-en-1-ynyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(but-3-en-1-ynyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170403777 |
| Molecular Formula | C15H9N3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2,4,6-tris(but-3-en-1-ynyl)-1,3,5-triazine |
| SMILES | C=CC#Cc1nc(C#CC=C)nc(C#CC=C)n1 |
| InChI | InChI=1S/C15H9N3/c1-4-7-10-13-16-14(11-8-5-2)18-15(17-13)12-9-6-3/h4-6H,1-3H2 |
| InChIKey | XLISTUBINZKJNV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|