About 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate
2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate (PubChem CID 170404310) has the molecular formula C17H20I3NO4
and a molecular weight of 683.06 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate |
| PubChem CID | 170404310 |
| Molecular Formula | C17H20I3NO4 |
| Molecular Weight | 683.06 g/mol |
| Exact Mass | 682.85 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate |
| SMILES | CC(=O)Oc1c(I)cc(I)c(C(=O)OC(C)(C)C2CCNCC2)c1I |
| InChI | InChI=1S/C17H20I3NO4/c1-9(22)24-15-12(19)8-11(18)13(14(15)20)16(23)25-17(2,3)10-4-6-21-7-5-10/h8,10,21H,4-7H2,1-3H3 |
| InChIKey | WTTUVXVDPLQZNI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 683.06 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate (CID 170404310) is 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate is CC(=O)Oc1c(I)cc(I)c(C(=O)OC(C)(C)C2CCNCC2)c1I.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate?
The InChIKey is WTTUVXVDPLQZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20I3NO4/c1-9(22)24-15-12(19)8-11(18)13(14(15)20)16(23)25-17(2,3)10-4-6-21-7-5-10/h8,10,21H,4-7H2,1-3H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate?
2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate has a molecular weight of 683.06 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 3-acetyloxy-2,4,6-triiodobenzoate is sourced from PubChem (CID 170404310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).