About 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol
2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol (PubChem CID 170404938) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol |
| PubChem CID | 170404938 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol |
| SMILES | CCCCCC/C=C/C1[C@@H](CC(O)O)CC[C@H]1O |
| InChI | InChI=1S/C15H28O3/c1-2-3-4-5-6-7-8-13-12(11-15(17)18)9-10-14(13)16/h7-8,12-18H,2-6,9-11H2,1H3/b8-7+/t12-,13?,14-/m1/s1 |
| InChIKey | UCMCWWNJSTUGQO-RWDIMFNUSA-N |
| XLogP | 2.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol?
The IUPAC name of 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol (CID 170404938) is 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol.
What is the SMILES notation for 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol?
The canonical SMILES for 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol is CCCCCC/C=C/C1[C@@H](CC(O)O)CC[C@H]1O.
What is the InChIKey of 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol?
The InChIKey is UCMCWWNJSTUGQO-RWDIMFNUSA-N. The full InChI is InChI=1S/C15H28O3/c1-2-3-4-5-6-7-8-13-12(11-15(17)18)9-10-14(13)16/h7-8,12-18H,2-6,9-11H2,1H3/b8-7+/t12-,13?,14-/m1/s1.
What are the key properties of 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol?
2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol has a molecular weight of 256.39 g/mol, XLogP of 2.60, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3R)-3-hydroxy-2-[(E)-oct-1-enyl]cyclopentyl]ethane-1,1-diol is sourced from PubChem (CID 170404938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).