C48H45N2O5PS — CID 170406798
(5E)-3-[[4-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]methyl]-5-[(6-ethyl-2,3-dihydro-1H-cyclopenta[c]carbazol-9-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 170406798) has the molecular formula C48H45N2O5PS and a molecular weight of 792.94 g/mol. Its IUPAC name is (5E)-3-[[4-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]methyl]-5-[(6-ethyl-2,3-dihydro-1H-cyclopenta[c]carbazol-9-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[[4-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]methyl]-5-[(6-ethyl-2,3-dihydro-1H-cyclopenta[c]carbazol-9-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 170406798 |
| Molecular Formula | C48H45N2O5PS |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.28 |
| IUPAC Name | (5E)-3-[[4-bis(2,4,6-trimethylbenzoyl)phosphorylphenyl]methyl]-5-[(6-ethyl-2,3-dihydro-1H-cyclopenta[c]carbazol-9-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCn1c2ccc(/C=C3/SC(=O)N(Cc4ccc(P(=O)(C(=O)c5c(C)cc(C)cc5C)C(=O)c5c(C)cc(C)cc5C)cc4)C3=O)cc2c2c3c(ccc21)CCC3 |
| InChI | InChI=1S/C48H45N2O5PS/c1-8-49-39-18-14-34(24-38(39)44-37-11-9-10-35(37)15-19-40(44)49)25-41-45(51)50(48(54)57-41)26-33-12-16-36(17-13-33)56(55,46(52)42-29(4)20-27(2)21-30(42)5)47(53)43-31(6)22-28(3)23-32(43)7/h12-25H,8-11,26H2,1-7H3/b41-25+ |
| InChIKey | WDYTUGSZPFFUNO-UACWCTJZSA-N |
| XLogP | 11.06 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|