About 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate
2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate (PubChem CID 170406800) has the molecular formula C27H24N2O5
and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate |
| PubChem CID | 170406800 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1C(=O)OC(Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H24N2O5/c1-2-25(30)33-18-17-28-26(31)24(34-27(28)32)19-20-13-15-23(16-14-20)29(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h2-16,24H,1,17-19H2 |
| InChIKey | JVZUAWQUSQHYNW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate?
The IUPAC name of 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate (CID 170406800) is 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate.
What is the SMILES notation for 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate?
The canonical SMILES for 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate is C=CC(=O)OCCN1C(=O)OC(Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)C1=O.
What is the InChIKey of 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate?
The InChIKey is JVZUAWQUSQHYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N2O5/c1-2-25(30)33-18-17-28-26(31)24(34-27(28)32)19-20-13-15-23(16-14-20)29(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h2-16,24H,1,17-19H2.
What are the key properties of 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate?
2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate has a molecular weight of 456.50 g/mol, XLogP of 4.78, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-dioxo-5-[[4-(N-phenylanilino)phenyl]methyl]-1,3-oxazolidin-3-yl]ethyl prop-2-enoate is sourced from PubChem (CID 170406800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).