C15H14FN5O5S — CID 170407099
5-[2-fluoro-6-hydroxy-4-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 170407099) has the molecular formula C15H14FN5O5S and a molecular weight of 395.37 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 170407099 |
| Molecular Formula | C15H14FN5O5S |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-[(4-oxo-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc(Nc3nc4c(c(=O)[nH]3)CCC4)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C15H14FN5O5S/c16-9-4-7(17-15-18-10-3-1-2-8(10)14(24)19-15)5-11(22)13(9)21-6-12(23)20-27(21,25)26/h4-5,22H,1-3,6H2,(H,20,23)(H2,17,18,19,24) |
| InChIKey | NRWZWCGFZZQLBI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |