C11H19F4IP2 — CID 170407261
(2,2,4,4-tetrafluoro-1-iodo-3,3-dimethyl-6-phosphanyl-6-propylcyclohexyl)phosphane (PubChem CID 170407261) has the molecular formula C11H19F4IP2 and a molecular weight of 416.12 g/mol. Its IUPAC name is (2,2,4,4-tetrafluoro-1-iodo-3,3-dimethyl-6-phosphanyl-6-propylcyclohexyl)phosphane.
| Compound Name | (2,2,4,4-tetrafluoro-1-iodo-3,3-dimethyl-6-phosphanyl-6-propylcyclohexyl)phosphane |
|---|---|
| PubChem CID | 170407261 |
| Molecular Formula | C11H19F4IP2 |
| Molecular Weight | 416.12 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | (2,2,4,4-tetrafluoro-1-iodo-3,3-dimethyl-6-phosphanyl-6-propylcyclohexyl)phosphane |
| SMILES | CCCC1(P)CC(F)(F)C(C)(C)C(F)(F)C1(P)I |
| InChI | InChI=1S/C11H19F4IP2/c1-4-5-8(17)6-9(12,13)7(2,3)10(14,15)11(8,16)18/h4-6,17-18H2,1-3H3 |
| InChIKey | ULWCEVCKMDCXKF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.12 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|