C11H18O4 — CID 170407566
ethyl (4R)-4-ethyl-5,5-dimethyl-3-oxooxolane-2-carboxylate (PubChem CID 170407566) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (4R)-4-ethyl-5,5-dimethyl-3-oxooxolane-2-carboxylate.
| Compound Name | ethyl (4R)-4-ethyl-5,5-dimethyl-3-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 170407566 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | ethyl (4R)-4-ethyl-5,5-dimethyl-3-oxooxolane-2-carboxylate |
| SMILES | CCOC(=O)C1OC(C)(C)[C@@H](CC)C1=O |
| InChI | InChI=1S/C11H18O4/c1-5-7-8(12)9(10(13)14-6-2)15-11(7,3)4/h7,9H,5-6H2,1-4H3/t7-,9?/m0/s1 |
| InChIKey | VWCDIMVJGGMXOZ-JAVCKPHESA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|