C28H29FN6O3S — CID 170407624
(2Z,4E)-2,5-diamino-N-benzylsulfanyl-5-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]penta-2,4-dienamide (PubChem CID 170407624) has the molecular formula C28H29FN6O3S and a molecular weight of 548.64 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-N-benzylsulfanyl-5-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,5-diamino-N-benzylsulfanyl-5-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 170407624 |
| Molecular Formula | C28H29FN6O3S |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (2Z,4E)-2,5-diamino-N-benzylsulfanyl-5-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]penta-2,4-dienamide |
| SMILES | N/C(=C\C=C(/N)N1CCN(C(=O)c2ccc(-c3cncc(O)c3)c(F)c2)CC1)C(=O)NSCc1ccccc1 |
| InChI | InChI=1S/C28H29FN6O3S/c29-24-15-20(6-7-23(24)21-14-22(36)17-32-16-21)28(38)35-12-10-34(11-13-35)26(31)9-8-25(30)27(37)33-39-18-19-4-2-1-3-5-19/h1-9,14-17,36H,10-13,18,30-31H2,(H,33,37)/b25-8-,26-9+ |
| InChIKey | LOZVKHHCTDWZPZ-QTQBJPPASA-N |
| XLogP | 2.96 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|