C16H15N3O4S — CID 170407663
N-(3,4-dimethyl-1H-indol-7-yl)-2-nitrobenzenesulfonamide (PubChem CID 170407663) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(3,4-dimethyl-1H-indol-7-yl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1H-indol-7-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 170407663 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(3,4-dimethyl-1H-indol-7-yl)-2-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2[N+](=O)[O-])c2[nH]cc(C)c12 |
| InChI | InChI=1S/C16H15N3O4S/c1-10-7-8-12(16-15(10)11(2)9-17-16)18-24(22,23)14-6-4-3-5-13(14)19(20)21/h3-9,17-18H,1-2H3 |
| InChIKey | IOADNAAQZCRVSG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|