C25H29N3O5 — CID 170408156
(13E,14Z)-7-ethyl-13,14-di(ethylidene)-7-hydroxy-15-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,15-tetraene-2,6-dione (PubChem CID 170408156) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is (13E,14Z)-7-ethyl-13,14-di(ethylidene)-7-hydroxy-15-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,15-tetraene-2,6-dione.
| Compound Name | (13E,14Z)-7-ethyl-13,14-di(ethylidene)-7-hydroxy-15-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,15-tetraene-2,6-dione |
|---|---|
| PubChem CID | 170408156 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (13E,14Z)-7-ethyl-13,14-di(ethylidene)-7-hydroxy-15-[(E)-(2-methylpropan-2-yl)oxyiminomethyl]-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,15-tetraene-2,6-dione |
| SMILES | C/C=c1/c(/C=N/OC(C)(C)C)c2c(n/c1=C/C)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
| InChI | InChI=1S/C25H29N3O5/c1-7-14-15(11-26-33-24(4,5)6)16-12-28-20(21(16)27-19(14)8-2)10-18-17(22(28)29)13-32-23(30)25(18,31)9-3/h7-8,10-11,31H,9,12-13H2,1-6H3/b14-7-,19-8+,26-11+ |
| InChIKey | PPFLTIFBKWIVDW-MTBNGHLXSA-N |
| XLogP | 1.68 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|