C28H43N11O7 — CID 170408157
4-[[2-(2-aminoethoxy)-4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-3-[2-(diaminomethylideneamino)ethoxy]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 170408157) has the molecular formula C28H43N11O7 and a molecular weight of 645.72 g/mol. Its IUPAC name is 4-[[2-(2-aminoethoxy)-4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-3-[2-(diaminomethylideneamino)ethoxy]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[2-(2-aminoethoxy)-4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-3-[2-(diaminomethylideneamino)ethoxy]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 170408157 |
| Molecular Formula | C28H43N11O7 |
| Molecular Weight | 645.72 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | 4-[[2-(2-aminoethoxy)-4-[2,3-bis[2-(diaminomethylideneamino)ethoxy]phenyl]-3-[2-(diaminomethylideneamino)ethoxy]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | NCCOc1c(CNC(=O)CCC(=O)O)ccc(-c2cccc(OCCN=C(N)N)c2OCCN=C(N)N)c1OCCN=C(N)N |
| InChI | InChI=1S/C28H43N11O7/c29-8-12-44-23-17(16-39-21(40)6-7-22(41)42)4-5-19(25(23)46-15-11-38-28(34)35)18-2-1-3-20(43-13-9-36-26(30)31)24(18)45-14-10-37-27(32)33/h1-5H,6-16,29H2,(H,39,40)(H,41,42)(H4,30,31,36)(H4,32,33,37)(H4,34,35,38) |
| InChIKey | SYRIIAYFHIEHIR-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 322.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.72 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|