About 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one
1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 170408700) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 170408700 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | [H]/N=C/N1CC2(C1)CN(C(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C11H19N3O/c1-10(2,3)9(15)14-6-11(7-14)4-13(5-11)8-12/h8,12H,4-7H2,1-3H3/b12-8+ |
| InChIKey | WYDLCYKLDXSGEP-XYOKQWHBSA-N |
| XLogP | 0.78 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one (CID 170408700) is 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one is [H]/N=C/N1CC2(C1)CN(C(=O)C(C)(C)C)C2.
What is the InChIKey of 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one?
The InChIKey is WYDLCYKLDXSGEP-XYOKQWHBSA-N. The full InChI is InChI=1S/C11H19N3O/c1-10(2,3)9(15)14-6-11(7-14)4-13(5-11)8-12/h8,12H,4-7H2,1-3H3/b12-8+.
What are the key properties of 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one?
1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one has a molecular weight of 209.29 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methanimidoyl-2,6-diazaspiro[3.3]heptan-2-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 170408700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).