C28H25FN6O3S — CID 170408984
N-benzylsulfanyl-6-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 170408984) has the molecular formula C28H25FN6O3S and a molecular weight of 544.61 g/mol. Its IUPAC name is N-benzylsulfanyl-6-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-benzylsulfanyl-6-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 170408984 |
| Molecular Formula | C28H25FN6O3S |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | N-benzylsulfanyl-6-[4-[3-fluoro-4-(5-hydroxy-3-pyridinyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | O=C(NSCc1ccccc1)c1ccc(N2CCN(C(=O)c3ccc(-c4cncc(O)c4)c(F)c3)CC2)nn1 |
| InChI | InChI=1S/C28H25FN6O3S/c29-24-15-20(6-7-23(24)21-14-22(36)17-30-16-21)28(38)35-12-10-34(11-13-35)26-9-8-25(31-32-26)27(37)33-39-18-19-4-2-1-3-5-19/h1-9,14-17,36H,10-13,18H2,(H,33,37) |
| InChIKey | JMIFYBAJSVTUHK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|