About N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide
N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 170409232) has the molecular formula C12H20F2N2OS
and a molecular weight of 278.37 g/mol. Its IUPAC name is N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 170409232 |
| Molecular Formula | C12H20F2N2OS |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(C#N)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H20F2N2OS/c1-11(2,3)18(17)16-10(8-15)9-5-4-6-12(13,14)7-9/h9-10,16H,4-7H2,1-3H3 |
| InChIKey | LBRRZBYRBKWYRM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide (CID 170409232) is N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)NC(C#N)C1CCCC(F)(F)C1.
What is the InChIKey of N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide?
The InChIKey is LBRRZBYRBKWYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N2OS/c1-11(2,3)18(17)16-10(8-15)9-5-4-6-12(13,14)7-9/h9-10,16H,4-7H2,1-3H3.
What are the key properties of N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide?
N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide has a molecular weight of 278.37 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyano-(3,3-difluorocyclohexyl)methyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 170409232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).