C36H34N+ — CID 170409360
2-[(1R)-6-methyl-4-[10-(5-methyl-1,5,6,8a-tetrahydronaphthalen-2-yl)-4,4a-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl]pyrrol-1-ium (PubChem CID 170409360) has the molecular formula C36H34N+ and a molecular weight of 480.68 g/mol. Its IUPAC name is 2-[(1R)-6-methyl-4-[10-(5-methyl-1,5,6,8a-tetrahydronaphthalen-2-yl)-4,4a-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl]pyrrol-1-ium.
| Compound Name | 2-[(1R)-6-methyl-4-[10-(5-methyl-1,5,6,8a-tetrahydronaphthalen-2-yl)-4,4a-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl]pyrrol-1-ium |
|---|---|
| PubChem CID | 170409360 |
| Molecular Formula | C36H34N+ |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 2-[(1R)-6-methyl-4-[10-(5-methyl-1,5,6,8a-tetrahydronaphthalen-2-yl)-4,4a-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl]pyrrol-1-ium |
| SMILES | CC1CC=CC2CC(C3=c4ccccc4=C(C4=CC(C)[C@H](C5=[N+]=CC=C5)C=C4)C4=CC=CCC43)=CC=C12 |
| InChI | InChI=1S/C36H34N/c1-23-9-7-10-25-22-27(16-18-28(23)25)36-32-13-5-3-11-30(32)35(31-12-4-6-14-33(31)36)26-17-19-29(24(2)21-26)34-15-8-20-37-34/h3-8,10-13,15-21,23-25,29,33H,9,14,22H2,1-2H3/q+1/t23?,24?,25?,29-,33?/m1/s1 |
| InChIKey | NFLAMTQGMZXOLG-UVRAXZNJSA-N |
| XLogP | 5.87 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|