C14H18O2 — CID 170409465
2,4-dimethyl-4a,5,10a,10b-tetrahydro-4H-azuleno[1,2-d][1,3]dioxine (PubChem CID 170409465) has the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2,4-dimethyl-4a,5,10a,10b-tetrahydro-4H-azuleno[1,2-d][1,3]dioxine.
| Compound Name | 2,4-dimethyl-4a,5,10a,10b-tetrahydro-4H-azuleno[1,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 170409465 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,4-dimethyl-4a,5,10a,10b-tetrahydro-4H-azuleno[1,2-d][1,3]dioxine |
| SMILES | CC1C2CC3=CC=CC=CC3C2OC(O1)C |
| InChI | InChI=1S/C14H18O2/c1-9-13-8-11-6-4-3-5-7-12(11)14(13)16-10(2)15-9/h3-7,9-10,12-14H,8H2,1-2H3 |
| InChIKey | VHYUIPQRNBQAER-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 367 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |