About 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide
3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide (PubChem CID 170409580) has the molecular formula C18H26F2N2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide |
| PubChem CID | 170409580 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide |
| SMILES | C=C(C)N/C(=N\C(C)(C)CC)c1cccc(C(C)(F)F)c1C |
| InChI | InChI=1S/C18H26F2N2/c1-8-17(5,6)22-16(21-12(2)3)14-10-9-11-15(13(14)4)18(7,19)20/h9-11H,2,8H2,1,3-7H3,(H,21,22) |
| InChIKey | IPGIIJWBNVOVIM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide?
The IUPAC name of 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide (CID 170409580) is 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide.
What is the SMILES notation for 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide?
The canonical SMILES for 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide is C=C(C)N/C(=N\C(C)(C)CC)c1cccc(C(C)(F)F)c1C.
What is the InChIKey of 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide?
The InChIKey is IPGIIJWBNVOVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2N2/c1-8-17(5,6)22-16(21-12(2)3)14-10-9-11-15(13(14)4)18(7,19)20/h9-11H,2,8H2,1,3-7H3,(H,21,22).
What are the key properties of 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide?
3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide has a molecular weight of 308.42 g/mol, XLogP of 5.17, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroethyl)-2-methyl-N'-(2-methylbutan-2-yl)-N-prop-1-en-2-ylbenzenecarboximidamide is sourced from PubChem (CID 170409580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).