About cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone
cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone (PubChem CID 170409924) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone |
| PubChem CID | 170409924 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone |
| SMILES | C/N=C1/C(C(=O)C2CC2)=CC=CC1=C(C)C |
| InChI | InChI=1S/C14H17NO/c1-9(2)11-5-4-6-12(13(11)15-3)14(16)10-7-8-10/h4-6,10H,7-8H2,1-3H3/b15-13+ |
| InChIKey | WOFKGBROJQZJRQ-FYWRMAATSA-N |
| XLogP | 2.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone?
The IUPAC name of cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone (CID 170409924) is cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone.
What is the SMILES notation for cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone?
The canonical SMILES for cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone is C/N=C1/C(C(=O)C2CC2)=CC=CC1=C(C)C.
What is the InChIKey of cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone?
The InChIKey is WOFKGBROJQZJRQ-FYWRMAATSA-N. The full InChI is InChI=1S/C14H17NO/c1-9(2)11-5-4-6-12(13(11)15-3)14(16)10-7-8-10/h4-6,10H,7-8H2,1-3H3/b15-13+.
What are the key properties of cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone?
cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone has a molecular weight of 215.30 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(6-methylimino-5-propan-2-ylidenecyclohexa-1,3-dien-1-yl)methanone is sourced from PubChem (CID 170409924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).