C13H13FN4OS — CID 170410596
4-butyl-9-fluoro-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 170410596) has the molecular formula C13H13FN4OS and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-butyl-9-fluoro-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-butyl-9-fluoro-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 170410596 |
| Molecular Formula | C13H13FN4OS |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-butyl-9-fluoro-1-sulfanylidene-2H-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCn1c(=O)c2cccc(F)c2n2c(=S)[nH]nc12 |
| InChI | InChI=1S/C13H13FN4OS/c1-2-3-7-17-11(19)8-5-4-6-9(14)10(8)18-12(17)15-16-13(18)20/h4-6H,2-3,7H2,1H3,(H,16,20) |
| InChIKey | FDDPYUWPYHLSLA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|