About 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one
8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one (PubChem CID 170411839) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one.
Molecular Properties
| Compound Name | 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one |
| PubChem CID | 170411839 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one |
| SMILES | CCOCC12CCCN1CC(=O)C2 |
| InChI | InChI=1S/C10H17NO2/c1-2-13-8-10-4-3-5-11(10)7-9(12)6-10/h2-8H2,1H3 |
| InChIKey | PIPMIFGSCDJFDP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one?
The IUPAC name of 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one (CID 170411839) is 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one.
What is the SMILES notation for 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one?
The canonical SMILES for 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one is CCOCC12CCCN1CC(=O)C2.
What is the InChIKey of 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one?
The InChIKey is PIPMIFGSCDJFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-13-8-10-4-3-5-11(10)7-9(12)6-10/h2-8H2,1H3.
What are the key properties of 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one?
8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one has a molecular weight of 183.25 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(ethoxymethyl)-3,5,6,7-tetrahydro-1H-pyrrolizin-2-one is sourced from PubChem (CID 170411839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).