C23H22FN5O4S — CID 170411906
(3R,7R)-19-(2,6-dimethylphenyl)-5-fluoro-15,15-dioxo-2-oxa-15λ6-thia-5,8,16,18,21-pentazatetracyclo[15.3.1.110,14.03,7]docosa-1(21),10(22),11,13,17,19-hexaen-9-one (PubChem CID 170411906) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is (3R,7R)-19-(2,6-dimethylphenyl)-5-fluoro-15,15-dioxo-2-oxa-15λ6-thia-5,8,16,18,21-pentazatetracyclo[15.3.1.110,14.03,7]docosa-1(21),10(22),11,13,17,19-hexaen-9-one.
| Compound Name | (3R,7R)-19-(2,6-dimethylphenyl)-5-fluoro-15,15-dioxo-2-oxa-15λ6-thia-5,8,16,18,21-pentazatetracyclo[15.3.1.110,14.03,7]docosa-1(21),10(22),11,13,17,19-hexaen-9-one |
|---|---|
| PubChem CID | 170411906 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (3R,7R)-19-(2,6-dimethylphenyl)-5-fluoro-15,15-dioxo-2-oxa-15λ6-thia-5,8,16,18,21-pentazatetracyclo[15.3.1.110,14.03,7]docosa-1(21),10(22),11,13,17,19-hexaen-9-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)(=O)c1cccc(c1)C(=O)N[C@@H]1CN(F)C[C@H]1O2 |
| InChI | InChI=1S/C23H22FN5O4S/c1-13-5-3-6-14(2)21(13)17-10-20-27-23(26-17)28-34(31,32)16-8-4-7-15(9-16)22(30)25-18-11-29(24)12-19(18)33-20/h3-10,18-19H,11-12H2,1-2H3,(H,25,30)(H,26,27,28)/t18-,19-/m1/s1 |
| InChIKey | MHCQFXOYHZAWTB-RTBURBONSA-N |
| XLogP | 2.62 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|