C53H42N2 — CID 170412101
9-[5-(5-phenylspiro[1,2-dihydrobenzo[b]fluorene-11,9'-4a,9a-dihydrofluorene]-2-yl)cyclohexa-1,3-dien-1-yl]-1,2,10,10a-tetrahydro-1,10-phenanthroline (PubChem CID 170412101) has the molecular formula C53H42N2 and a molecular weight of 706.93 g/mol. Its IUPAC name is 9-[5-(5-phenylspiro[1,2-dihydrobenzo[b]fluorene-11,9'-4a,9a-dihydrofluorene]-2-yl)cyclohexa-1,3-dien-1-yl]-1,2,10,10a-tetrahydro-1,10-phenanthroline.
| Compound Name | 9-[5-(5-phenylspiro[1,2-dihydrobenzo[b]fluorene-11,9'-4a,9a-dihydrofluorene]-2-yl)cyclohexa-1,3-dien-1-yl]-1,2,10,10a-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 170412101 |
| Molecular Formula | C53H42N2 |
| Molecular Weight | 706.93 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 9-[5-(5-phenylspiro[1,2-dihydrobenzo[b]fluorene-11,9'-4a,9a-dihydrofluorene]-2-yl)cyclohexa-1,3-dien-1-yl]-1,2,10,10a-tetrahydro-1,10-phenanthroline |
| SMILES | C1=CC(C2C=CC3=C(C2)C2(c4ccccc4C4C=CC=CC42)c2cc4ccccc4c(-c4ccccc4)c23)CC(C2=CC=C3C=CC4=C(NCC=C4)C3N2)=C1 |
| InChI | InChI=1S/C53H42N2/c1-2-12-33(13-3-1)49-40-18-5-4-14-38(40)32-47-50(49)43-27-25-37(31-46(43)53(47)44-21-8-6-19-41(44)42-20-7-9-22-45(42)53)36-15-10-16-39(30-36)48-28-26-35-24-23-34-17-11-29-54-51(34)52(35)55-48/h1-28,32,36-37,41,44,52,54-55H,29-31H2 |
| InChIKey | MYQVKQUTAICJBS-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.93 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |