About 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane
2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane (PubChem CID 170413071) has the molecular formula C21H36F2
and a molecular weight of 326.52 g/mol. Its IUPAC name is 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane |
| PubChem CID | 170413071 |
| Molecular Formula | C21H36F2 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane |
| SMILES | CC(C)C1CC2(C1)CC(C)(CCC(C)C1CCC(F)(F)CC1)C2 |
| InChI | InChI=1S/C21H36F2/c1-15(2)18-11-20(12-18)13-19(4,14-20)8-5-16(3)17-6-9-21(22,23)10-7-17/h15-18H,5-14H2,1-4H3 |
| InChIKey | CGVOTQVTOKRGMX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane?
The IUPAC name of 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane (CID 170413071) is 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane.
What is the SMILES notation for 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane?
The canonical SMILES for 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane is CC(C)C1CC2(C1)CC(C)(CCC(C)C1CCC(F)(F)CC1)C2.
What is the InChIKey of 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane?
The InChIKey is CGVOTQVTOKRGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36F2/c1-15(2)18-11-20(12-18)13-19(4,14-20)8-5-16(3)17-6-9-21(22,23)10-7-17/h15-18H,5-14H2,1-4H3.
What are the key properties of 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane?
2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane has a molecular weight of 326.52 g/mol, XLogP of 7.08, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4,4-difluorocyclohexyl)butyl]-2-methyl-6-propan-2-ylspiro[3.3]heptane is sourced from PubChem (CID 170413071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).