C49H94N2O2 — CID 170413396
(14Z,17E)-5-[5-[(3-amino-2-hydroxypropyl)-[(9E,12Z)-octadeca-9,12-dienyl]amino]pentyl]tricosa-14,17-dien-3-ol (PubChem CID 170413396) has the molecular formula C49H94N2O2 and a molecular weight of 743.30 g/mol. Its IUPAC name is (14Z,17E)-5-[5-[(3-amino-2-hydroxypropyl)-[(9E,12Z)-octadeca-9,12-dienyl]amino]pentyl]tricosa-14,17-dien-3-ol.
| Compound Name | (14Z,17E)-5-[5-[(3-amino-2-hydroxypropyl)-[(9E,12Z)-octadeca-9,12-dienyl]amino]pentyl]tricosa-14,17-dien-3-ol |
|---|---|
| PubChem CID | 170413396 |
| Molecular Formula | C49H94N2O2 |
| Molecular Weight | 743.30 g/mol |
| Exact Mass | 742.73 |
| IUPAC Name | (14Z,17E)-5-[5-[(3-amino-2-hydroxypropyl)-[(9E,12Z)-octadeca-9,12-dienyl]amino]pentyl]tricosa-14,17-dien-3-ol |
| SMILES | CCCCC/C=C\C/C=C/CCCCCCCCN(CCCCCC(CCCCCCCC/C=C\C/C=C/CCCCC)CC(O)CC)CC(O)CN |
| InChI | InChI=1S/C49H94N2O2/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-40-47(44-48(52)6-3)41-37-35-39-43-51(46-49(53)45-50)42-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h13-16,19-22,47-49,52-53H,4-12,17-18,23-46,50H2,1-3H3/b15-13+,16-14-,21-19-,22-20+ |
| InChIKey | MFNIKYZITCRCRL-BYTLRVDNSA-N |
| XLogP | 13.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.30 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|