About 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite
2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite (PubChem CID 170414006) has the molecular formula C5H7IN2OS
and a molecular weight of 270.09 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite |
| PubChem CID | 170414006 |
| Molecular Formula | C5H7IN2OS |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite |
| SMILES | Cc1nnc(CCOI)s1 |
| InChI | InChI=1S/C5H7IN2OS/c1-4-7-8-5(10-4)2-3-9-6/h2-3H2,1H3 |
| InChIKey | XSPYAEDEWMKFHM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite?
The IUPAC name of 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite (CID 170414006) is 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite.
What is the SMILES notation for 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite?
The canonical SMILES for 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite is Cc1nnc(CCOI)s1.
What is the InChIKey of 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite?
The InChIKey is XSPYAEDEWMKFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IN2OS/c1-4-7-8-5(10-4)2-3-9-6/h2-3H2,1H3.
What are the key properties of 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite?
2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite has a molecular weight of 270.09 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl hypoiodite is sourced from PubChem (CID 170414006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).