C26H28F3N3O2S — CID 170414212
(11R)-6-(2,6-dimethylphenyl)-11-(3,3,3-trifluoropropyl)-9-oxa-2λ4-thia-3,5,20-triazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaene 2-oxide (PubChem CID 170414212) has the molecular formula C26H28F3N3O2S and a molecular weight of 503.59 g/mol. Its IUPAC name is (11R)-6-(2,6-dimethylphenyl)-11-(3,3,3-trifluoropropyl)-9-oxa-2λ4-thia-3,5,20-triazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaene 2-oxide.
| Compound Name | (11R)-6-(2,6-dimethylphenyl)-11-(3,3,3-trifluoropropyl)-9-oxa-2λ4-thia-3,5,20-triazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaene 2-oxide |
|---|---|
| PubChem CID | 170414212 |
| Molecular Formula | C26H28F3N3O2S |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (11R)-6-(2,6-dimethylphenyl)-11-(3,3,3-trifluoropropyl)-9-oxa-2λ4-thia-3,5,20-triazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaene 2-oxide |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NS(=O)c1cccc(c1)CCC[C@H](CCC(F)(F)F)CO2 |
| InChI | InChI=1S/C26H28F3N3O2S/c1-17-6-3-7-18(2)24(17)22-15-23-31-25(30-22)32-35(33)21-11-5-9-19(14-21)8-4-10-20(16-34-23)12-13-26(27,28)29/h3,5-7,9,11,14-15,20H,4,8,10,12-13,16H2,1-2H3,(H,30,31,32)/t20-,35?/m1/s1 |
| InChIKey | YBNYLMOICOKQOX-NKMPOUKQSA-N |
| XLogP | 6.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |