C14H20F2N2O — CID 170414658
(1S)-1-[(3R)-3-(benzylamino)piperidin-3-yl]-2,2-difluoroethanol (PubChem CID 170414658) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is (1S)-1-[(3R)-3-(benzylamino)piperidin-3-yl]-2,2-difluoroethanol.
| Compound Name | (1S)-1-[(3R)-3-(benzylamino)piperidin-3-yl]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 170414658 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (1S)-1-[(3R)-3-(benzylamino)piperidin-3-yl]-2,2-difluoroethanol |
| SMILES | O[C@H](C(F)F)[C@@]1(NCc2ccccc2)CCCNC1 |
| InChI | InChI=1S/C14H20F2N2O/c15-13(16)12(19)14(7-4-8-17-10-14)18-9-11-5-2-1-3-6-11/h1-3,5-6,12-13,17-19H,4,7-10H2/t12-,14-/m1/s1 |
| InChIKey | UXQSMBQBMNHXLF-TZMCWYRMSA-N |
| XLogP | 1.52 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |