About N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine
N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine (PubChem CID 170414698) has the molecular formula C18H19N5O2S
and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine.
Molecular Properties
| Compound Name | N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine |
| PubChem CID | 170414698 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine |
| SMILES | [H]N=S(=O)(NC1CC1)c1ccc(Nc2ccnc3c(OC)nccc23)cc1 |
| InChI | InChI=1S/C18H19N5O2S/c1-25-18-17-15(8-10-21-18)16(9-11-20-17)22-12-4-6-14(7-5-12)26(19,24)23-13-2-3-13/h4-11,13H,2-3H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | YHFQGLHXGNPVIG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine?
The IUPAC name of N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine (CID 170414698) is N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine.
What is the SMILES notation for N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine?
The canonical SMILES for N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine is [H]N=S(=O)(NC1CC1)c1ccc(Nc2ccnc3c(OC)nccc23)cc1.
What is the InChIKey of N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine?
The InChIKey is YHFQGLHXGNPVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O2S/c1-25-18-17-15(8-10-21-18)16(9-11-20-17)22-12-4-6-14(7-5-12)26(19,24)23-13-2-3-13/h4-11,13H,2-3H2,1H3,(H,20,22)(H2,19,23,24).
What are the key properties of N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine?
N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine has a molecular weight of 369.45 g/mol, XLogP of 3.45, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(cyclopropylamino)sulfonimidoyl]phenyl]-8-methoxy-1,7-naphthyridin-4-amine is sourced from PubChem (CID 170414698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).