C35H24N2O3 — CID 170414803
3-(3,3-dimethylspiro[1H-indole-2,3'-benzo[f][1,4]benzoxazine]-8'-yl)phenanthrene-9,10-dione (PubChem CID 170414803) has the molecular formula C35H24N2O3 and a molecular weight of 520.59 g/mol. Its IUPAC name is 3-(3,3-dimethylspiro[1H-indole-2,3'-benzo[f][1,4]benzoxazine]-8'-yl)phenanthrene-9,10-dione.
| Compound Name | 3-(3,3-dimethylspiro[1H-indole-2,3'-benzo[f][1,4]benzoxazine]-8'-yl)phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 170414803 |
| Molecular Formula | C35H24N2O3 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3-(3,3-dimethylspiro[1H-indole-2,3'-benzo[f][1,4]benzoxazine]-8'-yl)phenanthrene-9,10-dione |
| SMILES | CC1(C)c2ccccc2NC12C=Nc1c(ccc3cc(-c4ccc5c(c4)-c4ccccc4C(=O)C5=O)ccc13)O2 |
| InChI | InChI=1S/C35H24N2O3/c1-34(2)28-9-5-6-10-29(28)37-35(34)19-36-31-23-14-11-20(17-22(23)13-16-30(31)40-35)21-12-15-26-27(18-21)24-7-3-4-8-25(24)32(38)33(26)39/h3-19,37H,1-2H3 |
| InChIKey | JLVJDUIZASJEFX-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|