C39H42F9N5O4 — CID 170415619
2-[[2-[1-(4,4-difluorocyclohexyl)-6-[1-(2,2,3,3-tetrafluoropropyl)piperidin-4-yl]oxyindol-3-yl]-4-(trifluoromethyl)pyrimidine-5-carbonyl]amino]adamantane-2-carboxylic acid (PubChem CID 170415619) has the molecular formula C39H42F9N5O4 and a molecular weight of 815.78 g/mol. Its IUPAC name is 2-[[2-[1-(4,4-difluorocyclohexyl)-6-[1-(2,2,3,3-tetrafluoropropyl)piperidin-4-yl]oxyindol-3-yl]-4-(trifluoromethyl)pyrimidine-5-carbonyl]amino]adamantane-2-carboxylic acid.
| Compound Name | 2-[[2-[1-(4,4-difluorocyclohexyl)-6-[1-(2,2,3,3-tetrafluoropropyl)piperidin-4-yl]oxyindol-3-yl]-4-(trifluoromethyl)pyrimidine-5-carbonyl]amino]adamantane-2-carboxylic acid |
|---|---|
| PubChem CID | 170415619 |
| Molecular Formula | C39H42F9N5O4 |
| Molecular Weight | 815.78 g/mol |
| Exact Mass | 815.31 |
| IUPAC Name | 2-[[2-[1-(4,4-difluorocyclohexyl)-6-[1-(2,2,3,3-tetrafluoropropyl)piperidin-4-yl]oxyindol-3-yl]-4-(trifluoromethyl)pyrimidine-5-carbonyl]amino]adamantane-2-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)C2CC3CC(C2)CC1C3)c1cnc(-c2cn(C3CCC(F)(F)CC3)c3cc(OC4CCN(CC(F)(F)C(F)F)CC4)ccc23)nc1C(F)(F)F |
| InChI | InChI=1S/C39H42F9N5O4/c40-34(41)37(44,45)19-52-9-5-25(6-10-52)57-26-1-2-27-29(18-53(30(27)16-26)24-3-7-36(42,43)8-4-24)32-49-17-28(31(50-32)39(46,47)48)33(54)51-38(35(55)56)22-12-20-11-21(14-22)15-23(38)13-20/h1-2,16-18,20-25,34H,3-15,19H2,(H,51,54)(H,55,56) |
| InChIKey | JISRDRIMHRYBRL-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.78 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|