C9H18O2 — CID 170415710
(2R,3S)-3-tert-butyl-2-methyloxolan-3-ol (PubChem CID 170415710) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (2R,3S)-3-tert-butyl-2-methyloxolan-3-ol.
| Compound Name | (2R,3S)-3-tert-butyl-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 170415710 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (2R,3S)-3-tert-butyl-2-methyloxolan-3-ol |
| SMILES | C[C@H]1OCC[C@]1(O)C(C)(C)C |
| InChI | InChI=1S/C9H18O2/c1-7-9(10,5-6-11-7)8(2,3)4/h7,10H,5-6H2,1-4H3/t7-,9-/m1/s1 |
| InChIKey | XJLKDPAADXRHKE-VXNVDRBHSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |