About 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole
6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole (PubChem CID 170416195) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole |
| PubChem CID | 170416195 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole |
| SMILES | Cc1cc(C(C)C)c2c(C(C)C)noc2c1C |
| InChI | InChI=1S/C15H21NO/c1-8(2)12-7-10(5)11(6)15-13(12)14(9(3)4)16-17-15/h7-9H,1-6H3 |
| InChIKey | JYPYIDIWFWRESC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole?
The IUPAC name of 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole (CID 170416195) is 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole.
What is the SMILES notation for 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole?
The canonical SMILES for 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole is Cc1cc(C(C)C)c2c(C(C)C)noc2c1C.
What is the InChIKey of 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole?
The InChIKey is JYPYIDIWFWRESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-8(2)12-7-10(5)11(6)15-13(12)14(9(3)4)16-17-15/h7-9H,1-6H3.
What are the key properties of 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole?
6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole has a molecular weight of 231.34 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-3,4-di(propan-2-yl)-1,2-benzoxazole is sourced from PubChem (CID 170416195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).