About 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine
1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine (PubChem CID 170416440) has the molecular formula C17H29N
and a molecular weight of 247.43 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine.
Molecular Properties
| Compound Name | 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine |
| PubChem CID | 170416440 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine |
| SMILES | CC(C)=C1C(=C(C)C)N(C(C)C)C=CC1C(C)C |
| InChI | InChI=1S/C17H29N/c1-11(2)15-9-10-18(14(7)8)17(13(5)6)16(15)12(3)4/h9-11,14-15H,1-8H3 |
| InChIKey | KTTDCXAVCCUENN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine?
The IUPAC name of 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine (CID 170416440) is 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine.
What is the SMILES notation for 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine?
The canonical SMILES for 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine is CC(C)=C1C(=C(C)C)N(C(C)C)C=CC1C(C)C.
What is the InChIKey of 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine?
The InChIKey is KTTDCXAVCCUENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N/c1-11(2)15-9-10-18(14(7)8)17(13(5)6)16(15)12(3)4/h9-11,14-15H,1-8H3.
What are the key properties of 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine?
1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine has a molecular weight of 247.43 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-di(propan-2-yl)-2,3-di(propan-2-ylidene)-4H-pyridine is sourced from PubChem (CID 170416440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).