About 2,5-di(cyclohexa-1,5-dien-1-yl)aniline
2,5-di(cyclohexa-1,5-dien-1-yl)aniline (PubChem CID 170416463) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2,5-di(cyclohexa-1,5-dien-1-yl)aniline.
Molecular Properties
| Compound Name | 2,5-di(cyclohexa-1,5-dien-1-yl)aniline |
| PubChem CID | 170416463 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2,5-di(cyclohexa-1,5-dien-1-yl)aniline |
| SMILES | Nc1cc(C2=CCCC=C2)ccc1C1=CCCC=C1 |
| InChI | InChI=1S/C18H19N/c19-18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h3,5,7-13H,1-2,4,6,19H2 |
| InChIKey | AOXQVMHJIACZOO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,5-di(cyclohexa-1,5-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-di(cyclohexa-1,5-dien-1-yl)aniline?
The IUPAC name of 2,5-di(cyclohexa-1,5-dien-1-yl)aniline (CID 170416463) is 2,5-di(cyclohexa-1,5-dien-1-yl)aniline.
What is the SMILES notation for 2,5-di(cyclohexa-1,5-dien-1-yl)aniline?
The canonical SMILES for 2,5-di(cyclohexa-1,5-dien-1-yl)aniline is Nc1cc(C2=CCCC=C2)ccc1C1=CCCC=C1.
What is the InChIKey of 2,5-di(cyclohexa-1,5-dien-1-yl)aniline?
The InChIKey is AOXQVMHJIACZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N/c19-18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15/h3,5,7-13H,1-2,4,6,19H2.
What are the key properties of 2,5-di(cyclohexa-1,5-dien-1-yl)aniline?
2,5-di(cyclohexa-1,5-dien-1-yl)aniline has a molecular weight of 249.36 g/mol, XLogP of 4.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-di(cyclohexa-1,5-dien-1-yl)aniline is sourced from PubChem (CID 170416463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).