About 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine
7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 170418313) has the molecular formula C11H11ClFN3
and a molecular weight of 239.68 g/mol. Its IUPAC name is 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 170418313 |
| Molecular Formula | C11H11ClFN3 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | C=CC(C)(C)c1cc(Cl)n2ncc(F)c2n1 |
| InChI | InChI=1S/C11H11ClFN3/c1-4-11(2,3)8-5-9(12)16-10(15-8)7(13)6-14-16/h4-6H,1H2,2-3H3 |
| InChIKey | KKZWBUOVODILCO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine (CID 170418313) is 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine is C=CC(C)(C)c1cc(Cl)n2ncc(F)c2n1.
What is the InChIKey of 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is KKZWBUOVODILCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClFN3/c1-4-11(2,3)8-5-9(12)16-10(15-8)7(13)6-14-16/h4-6H,1H2,2-3H3.
What are the key properties of 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine?
7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 239.68 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-fluoro-5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 170418313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).