C23H31N3OS — CID 170418802
N-[[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]methyl]-N-methyl-3-(methylaminosulfanyl)propanamide (PubChem CID 170418802) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]methyl]-N-methyl-3-(methylaminosulfanyl)propanamide.
| Compound Name | N-[[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]methyl]-N-methyl-3-(methylaminosulfanyl)propanamide |
|---|---|
| PubChem CID | 170418802 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[[4-[(3,3-dimethyl-1,2-dihydroinden-2-yl)amino]phenyl]methyl]-N-methyl-3-(methylaminosulfanyl)propanamide |
| SMILES | CNSCCC(=O)N(C)Cc1ccc(NC2Cc3ccccc3C2(C)C)cc1 |
| InChI | InChI=1S/C23H31N3OS/c1-23(2)20-8-6-5-7-18(20)15-21(23)25-19-11-9-17(10-12-19)16-26(4)22(27)13-14-28-24-3/h5-12,21,24-25H,13-16H2,1-4H3 |
| InChIKey | AQLYIGIVGUURTK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|