C23H25NOPS+ — CID 170419862
1-phenyl-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium 10-oxide (PubChem CID 170419862) has the molecular formula C23H25NOPS+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-phenyl-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium 10-oxide.
| Compound Name | 1-phenyl-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium 10-oxide |
|---|---|
| PubChem CID | 170419862 |
| Molecular Formula | C23H25NOPS+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-phenyl-2,10-di(propan-2-yl)-[1,4]benzothiaphosphinino[3,2-b]pyridin-1-ium 10-oxide |
| SMILES | CC(C)c1ccc2c([n+]1-c1ccccc1)P(=O)(C(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C23H25NOPS/c1-16(2)19-14-15-22-23(24(19)18-10-6-5-7-11-18)26(25,17(3)4)20-12-8-9-13-21(20)27-22/h5-17H,1-4H3/q+1 |
| InChIKey | HBGOPAAHFPTEJV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|