C10H10N6 — CID 170419893
N,5-dimethyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-8-amine (PubChem CID 170419893) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is N,5-dimethyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-8-amine.
| Compound Name | N,5-dimethyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-8-amine |
|---|---|
| PubChem CID | 170419893 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N,5-dimethyl-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaen-8-amine |
| SMILES | CNc1nn2c(C)nnc2c2ccncc12 |
| InChI | InChI=1S/C10H10N6/c1-6-13-14-10-7-3-4-12-5-8(7)9(11-2)15-16(6)10/h3-5H,1-2H3,(H,11,15) |
| InChIKey | YIDBZOFURJGTRE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |