About 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide
1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide (PubChem CID 170420107) has the molecular formula C20H19N2OS+
and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide.
Molecular Properties
| Compound Name | 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide |
| PubChem CID | 170420107 |
| Molecular Formula | C20H19N2OS+ |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide |
| SMILES | CC(C)N1c2ccccc2S(=O)c2ccc[n+](-c3ccccc3)c21 |
| InChI | InChI=1S/C20H19N2OS/c1-15(2)22-17-11-6-7-12-18(17)24(23)19-13-8-14-21(20(19)22)16-9-4-3-5-10-16/h3-15H,1-2H3/q+1 |
| InChIKey | TXURFAHNVZFBPA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide?
The IUPAC name of 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide (CID 170420107) is 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide.
What is the SMILES notation for 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide?
The canonical SMILES for 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide is CC(C)N1c2ccccc2S(=O)c2ccc[n+](-c3ccccc3)c21.
What is the InChIKey of 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide?
The InChIKey is TXURFAHNVZFBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N2OS/c1-15(2)22-17-11-6-7-12-18(17)24(23)19-13-8-14-21(20(19)22)16-9-4-3-5-10-16/h3-15H,1-2H3/q+1.
What are the key properties of 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide?
1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide has a molecular weight of 335.45 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-10-propan-2-ylpyrido[3,2-b][1,4]benzothiazin-1-ium 5-oxide is sourced from PubChem (CID 170420107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).