C28H26FN — CID 170420112
6-fluoro-13,14,15-trimethyl-26-azahexacyclo[12.11.1.02,11.05,10.016,25.018,23]hexacosa-1,3,5(10),6,8,11,16(25),17,19,21-decaene (PubChem CID 170420112) has the molecular formula C28H26FN and a molecular weight of 395.52 g/mol. Its IUPAC name is 6-fluoro-13,14,15-trimethyl-26-azahexacyclo[12.11.1.02,11.05,10.016,25.018,23]hexacosa-1,3,5(10),6,8,11,16(25),17,19,21-decaene.
| Compound Name | 6-fluoro-13,14,15-trimethyl-26-azahexacyclo[12.11.1.02,11.05,10.016,25.018,23]hexacosa-1,3,5(10),6,8,11,16(25),17,19,21-decaene |
|---|---|
| PubChem CID | 170420112 |
| Molecular Formula | C28H26FN |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 6-fluoro-13,14,15-trimethyl-26-azahexacyclo[12.11.1.02,11.05,10.016,25.018,23]hexacosa-1,3,5(10),6,8,11,16(25),17,19,21-decaene |
| SMILES | CC1C=c2c(ccc3c(F)cccc23)=C2NC1(C)C(C)C1=C2CC2C=CC=CC2=C1 |
| InChI | InChI=1S/C28H26FN/c1-16-13-24-20-9-6-10-26(29)21(20)11-12-22(24)27-25-15-19-8-5-4-7-18(19)14-23(25)17(2)28(16,3)30-27/h4-14,16-17,19,30H,15H2,1-3H3 |
| InChIKey | YSGAIKJSAWZYJD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |