C32H42O6S4 — CID 170421207
S-[3-[4-(3-acetylsulfanylpropoxy)-3-[2-(3-acetylsulfanylpropoxy)-5-(3-acetylsulfanylpropyl)phenyl]phenyl]propyl] ethanethioate (PubChem CID 170421207) has the molecular formula C32H42O6S4 and a molecular weight of 650.95 g/mol. Its IUPAC name is S-[3-[4-(3-acetylsulfanylpropoxy)-3-[2-(3-acetylsulfanylpropoxy)-5-(3-acetylsulfanylpropyl)phenyl]phenyl]propyl] ethanethioate.
| Compound Name | S-[3-[4-(3-acetylsulfanylpropoxy)-3-[2-(3-acetylsulfanylpropoxy)-5-(3-acetylsulfanylpropyl)phenyl]phenyl]propyl] ethanethioate |
|---|---|
| PubChem CID | 170421207 |
| Molecular Formula | C32H42O6S4 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | S-[3-[4-(3-acetylsulfanylpropoxy)-3-[2-(3-acetylsulfanylpropoxy)-5-(3-acetylsulfanylpropyl)phenyl]phenyl]propyl] ethanethioate |
| SMILES | CC(=O)SCCCOc1ccc(CCCSC(C)=O)cc1-c1cc(CCCSC(C)=O)ccc1OCCCSC(C)=O |
| InChI | InChI=1S/C32H42O6S4/c1-23(33)39-17-5-9-27-11-13-31(37-15-7-19-41-25(3)35)29(21-27)30-22-28(10-6-18-40-24(2)34)12-14-32(30)38-16-8-20-42-26(4)36/h11-14,21-22H,5-10,15-20H2,1-4H3 |
| InChIKey | MHQQNZJJDWTHLP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|