About 2-cyclopropyl-4,4-dimethylazepine
2-cyclopropyl-4,4-dimethylazepine (PubChem CID 170421896) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-cyclopropyl-4,4-dimethylazepine.
Molecular Properties
| Compound Name | 2-cyclopropyl-4,4-dimethylazepine |
| PubChem CID | 170421896 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-cyclopropyl-4,4-dimethylazepine |
| SMILES | CC1(C)C=CC=NC(C2CC2)=C1 |
| InChI | InChI=1S/C11H15N/c1-11(2)6-3-7-12-10(8-11)9-4-5-9/h3,6-9H,4-5H2,1-2H3 |
| InChIKey | PBRMQNSWESNPQB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-4,4-dimethylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4,4-dimethylazepine?
The IUPAC name of 2-cyclopropyl-4,4-dimethylazepine (CID 170421896) is 2-cyclopropyl-4,4-dimethylazepine.
What is the SMILES notation for 2-cyclopropyl-4,4-dimethylazepine?
The canonical SMILES for 2-cyclopropyl-4,4-dimethylazepine is CC1(C)C=CC=NC(C2CC2)=C1.
What is the InChIKey of 2-cyclopropyl-4,4-dimethylazepine?
The InChIKey is PBRMQNSWESNPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-11(2)6-3-7-12-10(8-11)9-4-5-9/h3,6-9H,4-5H2,1-2H3.
What are the key properties of 2-cyclopropyl-4,4-dimethylazepine?
2-cyclopropyl-4,4-dimethylazepine has a molecular weight of 161.25 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4,4-dimethylazepine is sourced from PubChem (CID 170421896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).