About 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane
2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane (PubChem CID 170423047) has the molecular formula C25H48N6
and a molecular weight of 432.70 g/mol. Its IUPAC name is 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane |
| PubChem CID | 170423047 |
| Molecular Formula | C25H48N6 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.39 |
| IUPAC Name | 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane |
| SMILES | CC(CCC(CCC(C)N1CC2(CCNC2)C1)N1CCNCC1)N1CCC2(CNC2)C1 |
| InChI | InChI=1S/C25H48N6/c1-21(30-12-8-24(18-30)15-28-16-24)3-5-23(29-13-10-26-11-14-29)6-4-22(2)31-19-25(20-31)7-9-27-17-25/h21-23,26-28H,3-20H2,1-2H3 |
| InChIKey | YFOYQASTSMUVIV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane?
The IUPAC name of 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane (CID 170423047) is 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane.
What is the SMILES notation for 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane?
The canonical SMILES for 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane is CC(CCC(CCC(C)N1CC2(CCNC2)C1)N1CCNCC1)N1CCC2(CNC2)C1.
What is the InChIKey of 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane?
The InChIKey is YFOYQASTSMUVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48N6/c1-21(30-12-8-24(18-30)15-28-16-24)3-5-23(29-13-10-26-11-14-29)6-4-22(2)31-19-25(20-31)7-9-27-17-25/h21-23,26-28H,3-20H2,1-2H3.
What are the key properties of 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane?
2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane has a molecular weight of 432.70 g/mol, XLogP of 1.19, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-(2,6-diazaspiro[3.4]octan-6-yl)-5-piperazin-1-ylnonan-2-yl]-2,7-diazaspiro[3.4]octane is sourced from PubChem (CID 170423047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).