C19H25ClFN5O3S — CID 170423053
tert-butyl N-[2-[(12S)-7-chloro-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]-N-methylcarbamate (PubChem CID 170423053) has the molecular formula C19H25ClFN5O3S and a molecular weight of 457.96 g/mol. Its IUPAC name is tert-butyl N-[2-[(12S)-7-chloro-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(12S)-7-chloro-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 170423053 |
| Molecular Formula | C19H25ClFN5O3S |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | tert-butyl N-[2-[(12S)-7-chloro-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]-N-methylcarbamate |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)OC[C@H](C)N2CCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25ClFN5O3S/c1-10-9-28-16-11-13(12(21)14(20)23-16)22-17(30-6)24-15(11)26(10)8-7-25(5)18(27)29-19(2,3)4/h10H,7-9H2,1-6H3/t10-/m0/s1 |
| InChIKey | GWBICRBXHROADT-JTQLQIEISA-N |
| XLogP | 3.99 |
| TPSA | 80.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|