C18H24F4N5OPS — CID 170423647
[12-ethyl-6-fluoro-7,13-dimethyl-11-(trifluoromethyl)-10-oxa-2,4,8,13,16-pentazatricyclo[7.7.1.05,17]heptadeca-1,3,5(17),6,8-pentaen-3-yl]sulfanyl-dimethylphosphane (PubChem CID 170423647) has the molecular formula C18H24F4N5OPS and a molecular weight of 465.46 g/mol. Its IUPAC name is [12-ethyl-6-fluoro-7,13-dimethyl-11-(trifluoromethyl)-10-oxa-2,4,8,13,16-pentazatricyclo[7.7.1.05,17]heptadeca-1,3,5(17),6,8-pentaen-3-yl]sulfanyl-dimethylphosphane.
| Compound Name | [12-ethyl-6-fluoro-7,13-dimethyl-11-(trifluoromethyl)-10-oxa-2,4,8,13,16-pentazatricyclo[7.7.1.05,17]heptadeca-1,3,5(17),6,8-pentaen-3-yl]sulfanyl-dimethylphosphane |
|---|---|
| PubChem CID | 170423647 |
| Molecular Formula | C18H24F4N5OPS |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [12-ethyl-6-fluoro-7,13-dimethyl-11-(trifluoromethyl)-10-oxa-2,4,8,13,16-pentazatricyclo[7.7.1.05,17]heptadeca-1,3,5(17),6,8-pentaen-3-yl]sulfanyl-dimethylphosphane |
| SMILES | CCC1C(C(F)(F)F)Oc2nc(C)c(F)c3nc(SP(C)C)nc(c23)NCCN1C |
| InChI | InChI=1S/C18H24F4N5OPS/c1-6-10-14(18(20,21)22)28-16-11-13(12(19)9(2)24-16)25-17(30-29(4)5)26-15(11)23-7-8-27(10)3/h10,14H,6-8H2,1-5H3,(H,23,25,26) |
| InChIKey | VJHNDZMHNUWTQF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|