C25H27N4O2P — CID 170424093
3-(6-methyloxan-3-yl)-1-[4-(3-methyl-2-phosphanylphenoxy)phenyl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 170424093) has the molecular formula C25H27N4O2P and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-(6-methyloxan-3-yl)-1-[4-(3-methyl-2-phosphanylphenoxy)phenyl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-(6-methyloxan-3-yl)-1-[4-(3-methyl-2-phosphanylphenoxy)phenyl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 170424093 |
| Molecular Formula | C25H27N4O2P |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3-(6-methyloxan-3-yl)-1-[4-(3-methyl-2-phosphanylphenoxy)phenyl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Cc1cccc(Oc2ccc(-c3nc(C4CCC(C)OC4)n4ccnc(N)c34)cc2)c1P |
| InChI | InChI=1S/C25H27N4O2P/c1-15-4-3-5-20(23(15)32)31-19-10-8-17(9-11-19)21-22-24(26)27-12-13-29(22)25(28-21)18-7-6-16(2)30-14-18/h3-5,8-13,16,18H,6-7,14,32H2,1-2H3,(H2,26,27) |
| InChIKey | TYWXWFSDDGLYDE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|